C13H10N4O2 — CID 41105372
4-[(4R)-1-(cyanomethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile (PubChem CID 41105372) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 4-[(4R)-1-(cyanomethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile.
| Compound Name | 4-[(4R)-1-(cyanomethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 41105372 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-[(4R)-1-(cyanomethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile |
| SMILES | C[C@]1(c2ccc(C#N)cc2)NC(=O)N(CC#N)C1=O |
| InChI | InChI=1S/C13H10N4O2/c1-13(10-4-2-9(8-15)3-5-10)11(18)17(7-6-14)12(19)16-13/h2-5H,7H2,1H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | WELIFDSGTDQFNW-CYBMUJFWSA-N |
| XLogP | 0.85 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|