C18H14N4O3 — CID 155555500
4-[4-methyl-2,5-dioxo-1-(2-oxo-2-pyridin-4-ylethyl)imidazolidin-4-yl]benzonitrile (PubChem CID 155555500) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 4-[4-methyl-2,5-dioxo-1-(2-oxo-2-pyridin-4-ylethyl)imidazolidin-4-yl]benzonitrile.
| Compound Name | 4-[4-methyl-2,5-dioxo-1-(2-oxo-2-pyridin-4-ylethyl)imidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 155555500 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-[4-methyl-2,5-dioxo-1-(2-oxo-2-pyridin-4-ylethyl)imidazolidin-4-yl]benzonitrile |
| SMILES | CC1(c2ccc(C#N)cc2)NC(=O)N(CC(=O)c2ccncc2)C1=O |
| InChI | InChI=1S/C18H14N4O3/c1-18(14-4-2-12(10-19)3-5-14)16(24)22(17(25)21-18)11-15(23)13-6-8-20-9-7-13/h2-9H,11H2,1H3,(H,21,25) |
| InChIKey | AXUIIOFJHLHVRX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|