C19H16N4O5S — CID 155535854
4-[1-[2-(3-cyanophenyl)-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzenesulfonamide (PubChem CID 155535854) has the molecular formula C19H16N4O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is 4-[1-[2-(3-cyanophenyl)-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzenesulfonamide.
| Compound Name | 4-[1-[2-(3-cyanophenyl)-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155535854 |
| Molecular Formula | C19H16N4O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-[1-[2-(3-cyanophenyl)-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzenesulfonamide |
| SMILES | CC1(c2ccc(S(N)(=O)=O)cc2)NC(=O)N(CC(=O)c2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C19H16N4O5S/c1-19(14-5-7-15(8-6-14)29(21,27)28)17(25)23(18(26)22-19)11-16(24)13-4-2-3-12(9-13)10-20/h2-9H,11H2,1H3,(H,22,26)(H2,21,27,28) |
| InChIKey | DFLDBHSCXLGRAP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 150.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|