C17H20N4O4 — CID 95273589
2-[(4S)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2S)-1-methoxypropan-2-yl]acetamide (PubChem CID 95273589) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[(4S)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2S)-1-methoxypropan-2-yl]acetamide.
| Compound Name | 2-[(4S)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2S)-1-methoxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 95273589 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[(4S)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2S)-1-methoxypropan-2-yl]acetamide |
| SMILES | COC[C@H](C)NC(=O)CN1C(=O)N[C@@](C)(c2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C17H20N4O4/c1-11(10-25-3)19-14(22)9-21-15(23)17(2,20-16(21)24)13-6-4-5-12(7-13)8-18/h4-7,11H,9-10H2,1-3H3,(H,19,22)(H,20,24)/t11-,17-/m0/s1 |
| InChIKey | XDDWQRWZWWUBFE-GTNSWQLSSA-N |
| XLogP | 0.48 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|