C17H20N4O3 — CID 94798161
2-[(4S)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-diethylacetamide (PubChem CID 94798161) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[(4S)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[(4S)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 94798161 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[(4S)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1C(=O)N[C@@](C)(c2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C17H20N4O3/c1-4-20(5-2)14(22)11-21-15(23)17(3,19-16(21)24)13-8-6-7-12(9-13)10-18/h6-9H,4-5,11H2,1-3H3,(H,19,24)/t17-/m0/s1 |
| InChIKey | OYCDSKBXZOLBRN-KRWDZBQOSA-N |
| XLogP | 1.19 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|