C17H18N4O4 — CID 94797847
3-[(4S)-4-methyl-1-(2-morpholin-4-yl-2-oxoethyl)-2,5-dioxoimidazolidin-4-yl]benzonitrile (PubChem CID 94797847) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-[(4S)-4-methyl-1-(2-morpholin-4-yl-2-oxoethyl)-2,5-dioxoimidazolidin-4-yl]benzonitrile.
| Compound Name | 3-[(4S)-4-methyl-1-(2-morpholin-4-yl-2-oxoethyl)-2,5-dioxoimidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 94797847 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[(4S)-4-methyl-1-(2-morpholin-4-yl-2-oxoethyl)-2,5-dioxoimidazolidin-4-yl]benzonitrile |
| SMILES | C[C@@]1(c2cccc(C#N)c2)NC(=O)N(CC(=O)N2CCOCC2)C1=O |
| InChI | InChI=1S/C17H18N4O4/c1-17(13-4-2-3-12(9-13)10-18)15(23)21(16(24)19-17)11-14(22)20-5-7-25-8-6-20/h2-4,9H,5-8,11H2,1H3,(H,19,24)/t17-/m0/s1 |
| InChIKey | NBPWJTCNXDQHBV-KRWDZBQOSA-N |
| XLogP | 0.18 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|