C17H17N5O3 — CID 94806174
N-(2-cyanoethyl)-2-[(4R)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide (PubChem CID 94806174) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[(4R)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[(4R)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 94806174 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(2-cyanoethyl)-2-[(4R)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide |
| SMILES | CN(CCC#N)C(=O)CN1C(=O)N[C@](C)(c2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C17H17N5O3/c1-17(13-6-3-5-12(9-13)10-19)15(24)22(16(25)20-17)11-14(23)21(2)8-4-7-18/h3,5-6,9H,4,8,11H2,1-2H3,(H,20,25)/t17-/m1/s1 |
| InChIKey | ZVZPCNFYXILPFL-QGZVFWFLSA-N |
| XLogP | 0.70 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|