C14H12BrN3O2 — CID 95339475
3-[(4S)-1-(2-bromoprop-2-enyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile (PubChem CID 95339475) has the molecular formula C14H12BrN3O2 and a molecular weight of 334.17 g/mol. Its IUPAC name is 3-[(4S)-1-(2-bromoprop-2-enyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile.
| Compound Name | 3-[(4S)-1-(2-bromoprop-2-enyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 95339475 |
| Molecular Formula | C14H12BrN3O2 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 3-[(4S)-1-(2-bromoprop-2-enyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile |
| SMILES | C=C(Br)CN1C(=O)N[C@@](C)(c2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C14H12BrN3O2/c1-9(15)8-18-12(19)14(2,17-13(18)20)11-5-3-4-10(6-11)7-16/h3-6H,1,8H2,2H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | WYZVXSKAMHQQMH-AWEZNQCLSA-N |
| XLogP | 2.23 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|