C19H14N4O2 — CID 94799539
2-[[(4R)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile (PubChem CID 94799539) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-[[(4R)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[(4R)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 94799539 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-[[(4R)-4-(3-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile |
| SMILES | C[C@]1(c2cccc(C#N)c2)NC(=O)N(Cc2ccccc2C#N)C1=O |
| InChI | InChI=1S/C19H14N4O2/c1-19(16-8-4-5-13(9-16)10-20)17(24)23(18(25)22-19)12-15-7-3-2-6-14(15)11-21/h2-9H,12H2,1H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | ZYVZPCZKFMZJOA-LJQANCHMSA-N |
| XLogP | 2.40 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|