C15H17N3O2 — CID 94132515
2-[[(4R)-4-methyl-2,5-dioxo-4-propylimidazolidin-1-yl]methyl]benzonitrile (PubChem CID 94132515) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[[(4R)-4-methyl-2,5-dioxo-4-propylimidazolidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[(4R)-4-methyl-2,5-dioxo-4-propylimidazolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 94132515 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-[[(4R)-4-methyl-2,5-dioxo-4-propylimidazolidin-1-yl]methyl]benzonitrile |
| SMILES | CCC[C@@]1(C)NC(=O)N(Cc2ccccc2C#N)C1=O |
| InChI | InChI=1S/C15H17N3O2/c1-3-8-15(2)13(19)18(14(20)17-15)10-12-7-5-4-6-11(12)9-16/h4-7H,3,8,10H2,1-2H3,(H,17,20)/t15-/m1/s1 |
| InChIKey | FCLRNBGTOIXXLU-OAHLLOKOSA-N |
| XLogP | 2.17 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|