C17H20N4O3 — CID 94870336
(5R)-3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyl-5-propylimidazolidine-2,4-dione (PubChem CID 94870336) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (5R)-3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyl-5-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyl-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94870336 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (5R)-3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyl-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@@]1(C)NC(=O)N(Cc2nc(Cc3ccccc3)no2)C1=O |
| InChI | InChI=1S/C17H20N4O3/c1-3-9-17(2)15(22)21(16(23)19-17)11-14-18-13(20-24-14)10-12-7-5-4-6-8-12/h4-8H,3,9-11H2,1-2H3,(H,19,23)/t17-/m1/s1 |
| InChIKey | ZNENPCXLRWISLF-QGZVFWFLSA-N |
| XLogP | 2.27 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|