C15H15FN4O3 — CID 51096214
3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 51096214) has the molecular formula C15H15FN4O3 and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51096214 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCc1noc(CN2C(=O)NC(C)(c3ccccc3F)C2=O)n1 |
| InChI | InChI=1S/C15H15FN4O3/c1-3-11-17-12(23-19-11)8-20-13(21)15(2,18-14(20)22)9-6-4-5-7-10(9)16/h4-7H,3,8H2,1-2H3,(H,18,22) |
| InChIKey | KQQFFYVTQNIWFC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|