C17H19ClN4O3 — CID 46529339
3-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 46529339) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is 3-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46529339 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-[(3-butyl-1,2,4-oxadiazol-5-yl)methyl]-5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCc1noc(CN2C(=O)NC(C)(c3ccc(Cl)cc3)C2=O)n1 |
| InChI | InChI=1S/C17H19ClN4O3/c1-3-4-5-13-19-14(25-21-13)10-22-15(23)17(2,20-16(22)24)11-6-8-12(18)9-7-11/h6-9H,3-5,10H2,1-2H3,(H,20,24) |
| InChIKey | QUGWNMYRFJWGRP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|