C20H16F2N4O3 — CID 43075450
3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 43075450) has the molecular formula C20H16F2N4O3 and a molecular weight of 398.37 g/mol. Its IUPAC name is 3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43075450 |
| Molecular Formula | C20H16F2N4O3 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)c(F)c2)NC(=O)N(Cc2nc(Cc3ccccc3)no2)C1=O |
| InChI | InChI=1S/C20H16F2N4O3/c1-20(13-7-8-14(21)15(22)10-13)18(27)26(19(28)24-20)11-17-23-16(25-29-17)9-12-5-3-2-4-6-12/h2-8,10H,9,11H2,1H3,(H,24,28) |
| InChIKey | FDAPTYPYPWOAAH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|