C17H13ClF2N2O2 — CID 46641069
3-[(3-chlorophenyl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 46641069) has the molecular formula C17H13ClF2N2O2 and a molecular weight of 350.75 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(3-chlorophenyl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46641069 |
| Molecular Formula | C17H13ClF2N2O2 |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)c(F)c2)NC(=O)N(Cc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C17H13ClF2N2O2/c1-17(11-5-6-13(19)14(20)8-11)15(23)22(16(24)21-17)9-10-3-2-4-12(18)7-10/h2-8H,9H2,1H3,(H,21,24) |
| InChIKey | DCEHJKCVXISAKL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|