C18H15F2N3O3 — CID 55631250
3-[[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzamide (PubChem CID 55631250) has the molecular formula C18H15F2N3O3 and a molecular weight of 359.33 g/mol. Its IUPAC name is 3-[[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzamide.
| Compound Name | 3-[[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 55631250 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-[[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzamide |
| SMILES | CC1(c2ccc(F)c(F)c2)NC(=O)N(Cc2cccc(C(N)=O)c2)C1=O |
| InChI | InChI=1S/C18H15F2N3O3/c1-18(12-5-6-13(19)14(20)8-12)16(25)23(17(26)22-18)9-10-3-2-4-11(7-10)15(21)24/h2-8H,9H2,1H3,(H2,21,24)(H,22,26) |
| InChIKey | LMZITJNJUCLJPH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|