C18H18N6O3 — CID 97090177
(5R)-3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyl-5-(1-methylpyrazol-4-yl)imidazolidine-2,4-dione (PubChem CID 97090177) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is (5R)-3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyl-5-(1-methylpyrazol-4-yl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyl-5-(1-methylpyrazol-4-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97090177 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (5R)-3-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyl-5-(1-methylpyrazol-4-yl)imidazolidine-2,4-dione |
| SMILES | Cn1cc([C@@]2(C)NC(=O)N(Cc3nc(Cc4ccccc4)no3)C2=O)cn1 |
| InChI | InChI=1S/C18H18N6O3/c1-18(13-9-19-23(2)10-13)16(25)24(17(26)21-18)11-15-20-14(22-27-15)8-12-6-4-3-5-7-12/h3-7,9-10H,8,11H2,1-2H3,(H,21,26)/t18-/m1/s1 |
| InChIKey | ZEJJJSAMPKPCJG-GOSISDBHSA-N |
| XLogP | 1.36 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|