C16H16N4O4 — CID 132971291
4-[[4-methyl-4-(1-methylpyrazol-4-yl)-2,5-dioxoimidazolidin-1-yl]methyl]benzoic acid (PubChem CID 132971291) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 4-[[4-methyl-4-(1-methylpyrazol-4-yl)-2,5-dioxoimidazolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-methyl-4-(1-methylpyrazol-4-yl)-2,5-dioxoimidazolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 132971291 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-[[4-methyl-4-(1-methylpyrazol-4-yl)-2,5-dioxoimidazolidin-1-yl]methyl]benzoic acid |
| SMILES | Cn1cc(C2(C)NC(=O)N(Cc3ccc(C(=O)O)cc3)C2=O)cn1 |
| InChI | InChI=1S/C16H16N4O4/c1-16(12-7-17-19(2)9-12)14(23)20(15(24)18-16)8-10-3-5-11(6-4-10)13(21)22/h3-7,9H,8H2,1-2H3,(H,18,24)(H,21,22) |
| InChIKey | DAGZESXJGOHUES-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|