C15H14F2N4O3 — CID 51075953
5-(2,5-difluorophenyl)-3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 51075953) has the molecular formula C15H14F2N4O3 and a molecular weight of 336.30 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,5-difluorophenyl)-3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51075953 |
| Molecular Formula | C15H14F2N4O3 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-(2,5-difluorophenyl)-3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCc1noc(CN2C(=O)NC(C)(c3cc(F)ccc3F)C2=O)n1 |
| InChI | InChI=1S/C15H14F2N4O3/c1-3-11-18-12(24-20-11)7-21-13(22)15(2,19-14(21)23)9-6-8(16)4-5-10(9)17/h4-6H,3,7H2,1-2H3,(H,19,23) |
| InChIKey | SNCZVRDIQVJVJP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|