C14H18F2N2O2Si — CID 56529238
5-(2,5-difluorophenyl)-5-methyl-3-(trimethylsilylmethyl)imidazolidine-2,4-dione (PubChem CID 56529238) has the molecular formula C14H18F2N2O2Si and a molecular weight of 312.39 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-5-methyl-3-(trimethylsilylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-(2,5-difluorophenyl)-5-methyl-3-(trimethylsilylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56529238 |
| Molecular Formula | C14H18F2N2O2Si |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 5-(2,5-difluorophenyl)-5-methyl-3-(trimethylsilylmethyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2cc(F)ccc2F)NC(=O)N(C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C14H18F2N2O2Si/c1-14(10-7-9(15)5-6-11(10)16)12(19)18(13(20)17-14)8-21(2,3)4/h5-7H,8H2,1-4H3,(H,17,20) |
| InChIKey | DJKPGCFWZCDPBC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|