C18H23F2N3O3 — CID 7801378
2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide (PubChem CID 7801378) has the molecular formula C18H23F2N3O3 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 7801378 |
| Molecular Formula | C18H23F2N3O3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)CN1C(=O)N[C@@](C)(c2cc(F)ccc2F)C1=O)C(C)C |
| InChI | InChI=1S/C18H23F2N3O3/c1-10(2)23(11(3)4)15(24)9-22-16(25)18(5,21-17(22)26)13-8-12(19)6-7-14(13)20/h6-8,10-11H,9H2,1-5H3,(H,21,26)/t18-/m0/s1 |
| InChIKey | DNSALGOYAPRFEW-SFHVURJKSA-N |
| XLogP | 2.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|