C20H19F2N3O3 — CID 7801285
2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 7801285) has the molecular formula C20H19F2N3O3 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 7801285 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[(4S)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CN1C(=O)N[C@@](C)(c2cc(F)ccc2F)C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H19F2N3O3/c1-12(13-6-4-3-5-7-13)23-17(26)11-25-18(27)20(2,24-19(25)28)15-10-14(21)8-9-16(15)22/h3-10,12H,11H2,1-2H3,(H,23,26)(H,24,28)/t12-,20+/m1/s1 |
| InChIKey | JFHYSXZSNBYVIQ-ODXCJYRJSA-N |
| XLogP | 2.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|