C19H16ClF2N3O3 — CID 55374728
N-[(3-chlorophenyl)methyl]-2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55374728) has the molecular formula C19H16ClF2N3O3 and a molecular weight of 407.80 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55374728 |
| Molecular Formula | C19H16ClF2N3O3 |
| Molecular Weight | 407.80 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2cc(F)ccc2F)NC(=O)N(CC(=O)NCc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C19H16ClF2N3O3/c1-19(14-8-13(21)5-6-15(14)22)17(27)25(18(28)24-19)10-16(26)23-9-11-3-2-4-12(20)7-11/h2-8H,9-10H2,1H3,(H,23,26)(H,24,28) |
| InChIKey | MOTRSPJVIPTLFU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|