C16H12F2N2O3S — CID 7561979
(5S)-5-(2,5-difluorophenyl)-5-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 7561979) has the molecular formula C16H12F2N2O3S and a molecular weight of 350.35 g/mol. Its IUPAC name is (5S)-5-(2,5-difluorophenyl)-5-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,5-difluorophenyl)-5-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7561979 |
| Molecular Formula | C16H12F2N2O3S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (5S)-5-(2,5-difluorophenyl)-5-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cc(F)ccc2F)NC(=O)N(CC(=O)c2cccs2)C1=O |
| InChI | InChI=1S/C16H12F2N2O3S/c1-16(10-7-9(17)4-5-11(10)18)14(22)20(15(23)19-16)8-12(21)13-3-2-6-24-13/h2-7H,8H2,1H3,(H,19,23)/t16-/m0/s1 |
| InChIKey | SPFKZMWWNPZMJJ-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|