C20H19F2N3O4S — CID 55450329
N-[2-[5-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]thiophen-2-yl]ethyl]acetamide (PubChem CID 55450329) has the molecular formula C20H19F2N3O4S and a molecular weight of 435.45 g/mol. Its IUPAC name is N-[2-[5-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]thiophen-2-yl]ethyl]acetamide.
| Compound Name | N-[2-[5-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]thiophen-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 55450329 |
| Molecular Formula | C20H19F2N3O4S |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[2-[5-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]thiophen-2-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(C(=O)CN2C(=O)NC(C)(c3cc(F)ccc3F)C2=O)s1 |
| InChI | InChI=1S/C20H19F2N3O4S/c1-11(26)23-8-7-13-4-6-17(30-13)16(27)10-25-18(28)20(2,24-19(25)29)14-9-12(21)3-5-15(14)22/h3-6,9H,7-8,10H2,1-2H3,(H,23,26)(H,24,29) |
| InChIKey | ZWZSAOKWEXWBCZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|