C18H16F2N2O3S — CID 8597585
(5R)-5-(2,5-difluorophenyl)-3-[2-(5-ethylthiophen-2-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 8597585) has the molecular formula C18H16F2N2O3S and a molecular weight of 378.40 g/mol. Its IUPAC name is (5R)-5-(2,5-difluorophenyl)-3-[2-(5-ethylthiophen-2-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2,5-difluorophenyl)-3-[2-(5-ethylthiophen-2-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8597585 |
| Molecular Formula | C18H16F2N2O3S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (5R)-5-(2,5-difluorophenyl)-3-[2-(5-ethylthiophen-2-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCc1ccc(C(=O)CN2C(=O)N[C@](C)(c3cc(F)ccc3F)C2=O)s1 |
| InChI | InChI=1S/C18H16F2N2O3S/c1-3-11-5-7-15(26-11)14(23)9-22-16(24)18(2,21-17(22)25)12-8-10(19)4-6-13(12)20/h4-8H,3,9H2,1-2H3,(H,21,25)/t18-/m1/s1 |
| InChIKey | IDIFAYIIJOYHMU-GOSISDBHSA-N |
| XLogP | 3.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|