C24H26F2N2O3 — CID 46552369
5-(2,5-difluorophenyl)-3-[2-(4-hexylphenyl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 46552369) has the molecular formula C24H26F2N2O3 and a molecular weight of 428.48 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-3-[2-(4-hexylphenyl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,5-difluorophenyl)-3-[2-(4-hexylphenyl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46552369 |
| Molecular Formula | C24H26F2N2O3 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-(2,5-difluorophenyl)-3-[2-(4-hexylphenyl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCCCc1ccc(C(=O)CN2C(=O)NC(C)(c3cc(F)ccc3F)C2=O)cc1 |
| InChI | InChI=1S/C24H26F2N2O3/c1-3-4-5-6-7-16-8-10-17(11-9-16)21(29)15-28-22(30)24(2,27-23(28)31)19-14-18(25)12-13-20(19)26/h8-14H,3-7,15H2,1-2H3,(H,27,31) |
| InChIKey | DWVKTCWXSNXMMP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|