C21H17F2N3O4 — CID 9060172
(5S)-5-(2,5-difluorophenyl)-5-methyl-3-[2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 9060172) has the molecular formula C21H17F2N3O4 and a molecular weight of 413.38 g/mol. Its IUPAC name is (5S)-5-(2,5-difluorophenyl)-5-methyl-3-[2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,5-difluorophenyl)-5-methyl-3-[2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9060172 |
| Molecular Formula | C21H17F2N3O4 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (5S)-5-(2,5-difluorophenyl)-5-methyl-3-[2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)Cc2cc(C(=O)CN3C(=O)N[C@@](C)(c4cc(F)ccc4F)C3=O)ccc21 |
| InChI | InChI=1S/C21H17F2N3O4/c1-21(14-9-13(22)4-5-15(14)23)19(29)26(20(30)24-21)10-17(27)11-3-6-16-12(7-11)8-18(28)25(16)2/h3-7,9H,8,10H2,1-2H3,(H,24,30)/t21-/m0/s1 |
| InChIKey | HNGLHTDCPUALML-NRFANRHFSA-N |
| XLogP | 2.13 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|