C20H15F2N3O5 — CID 43034219
5-(2,5-difluorophenyl)-5-methyl-3-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 43034219) has the molecular formula C20H15F2N3O5 and a molecular weight of 415.35 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-5-methyl-3-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,5-difluorophenyl)-5-methyl-3-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43034219 |
| Molecular Formula | C20H15F2N3O5 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 5-(2,5-difluorophenyl)-5-methyl-3-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2cc(F)ccc2F)NC(=O)N(CC(=O)c2ccc3c(c2)NC(=O)CO3)C1=O |
| InChI | InChI=1S/C20H15F2N3O5/c1-20(12-7-11(21)3-4-13(12)22)18(28)25(19(29)24-20)8-15(26)10-2-5-16-14(6-10)23-17(27)9-30-16/h2-7H,8-9H2,1H3,(H,23,27)(H,24,29) |
| InChIKey | YRQRYDKKTHAJLH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|