C19H16F2N4O4 — CID 7561970
4-[[2-[(4R)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 7561970) has the molecular formula C19H16F2N4O4 and a molecular weight of 402.36 g/mol. Its IUPAC name is 4-[[2-[(4R)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(4R)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 7561970 |
| Molecular Formula | C19H16F2N4O4 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-[[2-[(4R)-4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | C[C@]1(c2cc(F)ccc2F)NC(=O)N(CC(=O)Nc2ccc(C(N)=O)cc2)C1=O |
| InChI | InChI=1S/C19H16F2N4O4/c1-19(13-8-11(20)4-7-14(13)21)17(28)25(18(29)24-19)9-15(26)23-12-5-2-10(3-6-12)16(22)27/h2-8H,9H2,1H3,(H2,22,27)(H,23,26)(H,24,29)/t19-/m1/s1 |
| InChIKey | DLMQELVUTVHVEF-LJQANCHMSA-N |
| XLogP | 1.47 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|