C19H17BrN4O4 — CID 40810147
4-[[2-[(4S)-4-(4-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 40810147) has the molecular formula C19H17BrN4O4 and a molecular weight of 445.27 g/mol. Its IUPAC name is 4-[[2-[(4S)-4-(4-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(4S)-4-(4-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 40810147 |
| Molecular Formula | C19H17BrN4O4 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 4-[[2-[(4S)-4-(4-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | C[C@@]1(c2ccc(Br)cc2)NC(=O)N(CC(=O)Nc2ccc(C(N)=O)cc2)C1=O |
| InChI | InChI=1S/C19H17BrN4O4/c1-19(12-4-6-13(20)7-5-12)17(27)24(18(28)23-19)10-15(25)22-14-8-2-11(3-9-14)16(21)26/h2-9H,10H2,1H3,(H2,21,26)(H,22,25)(H,23,28)/t19-/m0/s1 |
| InChIKey | XMSWFQJQCXZWKQ-IBGZPJMESA-N |
| XLogP | 1.95 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|