C20H19FN4O5 — CID 55567225
N-[4-(2-amino-2-oxoethoxy)phenyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55567225) has the molecular formula C20H19FN4O5 and a molecular weight of 414.39 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethoxy)phenyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55567225 |
| Molecular Formula | C20H19FN4O5 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2ccc(OCC(N)=O)cc2)C1=O |
| InChI | InChI=1S/C20H19FN4O5/c1-20(12-2-4-13(21)5-3-12)18(28)25(19(29)24-20)10-17(27)23-14-6-8-15(9-7-14)30-11-16(22)26/h2-9H,10-11H2,1H3,(H2,22,26)(H,23,27)(H,24,29) |
| InChIKey | GYZKPWLVOVCXMR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|