C21H17FN4O3S — CID 18279498
2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide (PubChem CID 18279498) has the molecular formula C21H17FN4O3S and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 18279498 |
| Molecular Formula | C21H17FN4O3S |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2ccc(-c3nccs3)cc2)C1=O |
| InChI | InChI=1S/C21H17FN4O3S/c1-21(14-4-6-15(22)7-5-14)19(28)26(20(29)25-21)12-17(27)24-16-8-2-13(3-9-16)18-23-10-11-30-18/h2-11H,12H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | FXNNHGXTOOZREQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|