C14H12FN5O3S — CID 30550988
2-[(4R)-4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 30550988) has the molecular formula C14H12FN5O3S and a molecular weight of 349.35 g/mol. Its IUPAC name is 2-[(4R)-4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(4R)-4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 30550988 |
| Molecular Formula | C14H12FN5O3S |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[(4R)-4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C[C@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2nncs2)C1=O |
| InChI | InChI=1S/C14H12FN5O3S/c1-14(8-2-4-9(15)5-3-8)11(22)20(13(23)18-14)6-10(21)17-12-19-16-7-24-12/h2-5,7H,6H2,1H3,(H,18,23)(H,17,19,21)/t14-/m1/s1 |
| InChIKey | TUTVPYCPISJFGW-CQSZACIVSA-N |
| XLogP | 1.08 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|