C22H23FN4O4 — CID 46513573
N-[4-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]phenyl]-2-methylpropanamide (PubChem CID 46513573) has the molecular formula C22H23FN4O4 and a molecular weight of 426.45 g/mol. Its IUPAC name is N-[4-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 46513573 |
| Molecular Formula | C22H23FN4O4 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[4-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(NC(=O)CN2C(=O)NC(C)(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H23FN4O4/c1-13(2)19(29)25-17-10-8-16(9-11-17)24-18(28)12-27-20(30)22(3,26-21(27)31)14-4-6-15(23)7-5-14/h4-11,13H,12H2,1-3H3,(H,24,28)(H,25,29)(H,26,31) |
| InChIKey | BQQHLJLXMORBAU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|