C21H15Cl2FN4O3S — CID 43042831
N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 43042831) has the molecular formula C21H15Cl2FN4O3S and a molecular weight of 493.35 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 43042831 |
| Molecular Formula | C21H15Cl2FN4O3S |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)C1=O |
| InChI | InChI=1S/C21H15Cl2FN4O3S/c1-21(11-2-5-13(24)6-3-11)18(30)28(20(31)27-21)9-17(29)26-19-25-16(10-32-19)14-7-4-12(22)8-15(14)23/h2-8,10H,9H2,1H3,(H,27,31)(H,25,26,29) |
| InChIKey | DQYSPCOJADFDIL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|