C22H19BrN4O3S — CID 112760869
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 112760869) has the molecular formula C22H19BrN4O3S and a molecular weight of 499.39 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 112760869 |
| Molecular Formula | C22H19BrN4O3S |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)Nc3nc(-c4cccc(Br)c4)cs3)C2=O)cc1 |
| InChI | InChI=1S/C22H19BrN4O3S/c1-13-6-8-15(9-7-13)22(2)19(29)27(21(30)26-22)11-18(28)25-20-24-17(12-31-20)14-4-3-5-16(23)10-14/h3-10,12H,11H2,1-2H3,(H,26,30)(H,24,25,28) |
| InChIKey | GRCNEQXTGHVRJK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|