C18H19FN4O3S — CID 46629011
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 46629011) has the molecular formula C18H19FN4O3S and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 46629011 |
| Molecular Formula | C18H19FN4O3S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2nc(-c3cccc(F)c3)cs2)C1=O |
| InChI | InChI=1S/C18H19FN4O3S/c1-3-18(4-2)15(25)23(17(26)22-18)9-14(24)21-16-20-13(10-27-16)11-6-5-7-12(19)8-11/h5-8,10H,3-4,9H2,1-2H3,(H,22,26)(H,20,21,24) |
| InChIKey | PTNUYAHNBWIQDQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|