C23H20N4O5S — CID 16547029
N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 16547029) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 16547029 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2nc(-c3ccc4c(c3)OCO4)cs2)C1=O |
| InChI | InChI=1S/C23H20N4O5S/c1-2-23(15-6-4-3-5-7-15)20(29)27(22(30)26-23)11-19(28)25-21-24-16(12-33-21)14-8-9-17-18(10-14)32-13-31-17/h3-10,12H,2,11,13H2,1H3,(H,26,30)(H,24,25,28) |
| InChIKey | SARXDSXTFITJFQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|