C19H16N2O4S — CID 30728939
N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-phenoxypropanamide (PubChem CID 30728939) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-phenoxypropanamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 30728939 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-phenoxypropanamide |
| SMILES | O=C(CCOc1ccccc1)Nc1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C19H16N2O4S/c22-18(8-9-23-14-4-2-1-3-5-14)21-19-20-15(11-26-19)13-6-7-16-17(10-13)25-12-24-16/h1-7,10-11H,8-9,12H2,(H,20,21,22) |
| InChIKey | CLSKUEDJTZOKJX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |