C20H16N2O5S — CID 17430597
2-(4-acetylphenoxy)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 17430597) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-(4-acetylphenoxy)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-acetylphenoxy)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17430597 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-(4-acetylphenoxy)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)c1ccc(OCC(=O)Nc2nc(-c3ccc4c(c3)OCO4)cs2)cc1 |
| InChI | InChI=1S/C20H16N2O5S/c1-12(23)13-2-5-15(6-3-13)25-9-19(24)22-20-21-16(10-28-20)14-4-7-17-18(8-14)27-11-26-17/h2-8,10H,9,11H2,1H3,(H,21,22,24) |
| InChIKey | QXOZWXALXYTVEL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |