C19H13FN4O2S — CID 32623205
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-2-(2-oxoquinoxalin-1-yl)acetamide (PubChem CID 32623205) has the molecular formula C19H13FN4O2S and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-2-(2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-2-(2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 32623205 |
| Molecular Formula | C19H13FN4O2S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-2-(2-oxoquinoxalin-1-yl)acetamide |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)Nc1nc(-c2cccc(F)c2)cs1 |
| InChI | InChI=1S/C19H13FN4O2S/c20-13-5-3-4-12(8-13)15-11-27-19(22-15)23-17(25)10-24-16-7-2-1-6-14(16)21-9-18(24)26/h1-9,11H,10H2,(H,22,23,25) |
| InChIKey | UJMWLJGXNHEIFX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |