C23H24N4O2S — CID 24575834
N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(2-oxoquinoxalin-1-yl)acetamide (PubChem CID 24575834) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 24575834 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(2-oxoquinoxalin-1-yl)acetamide |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C23H24N4O2S/c28-20(12-27-18-4-2-1-3-17(18)24-11-21(27)29)26-22-25-19(13-30-22)23-8-14-5-15(9-23)7-16(6-14)10-23/h1-4,11,13-16H,5-10,12H2,(H,25,26,28) |
| InChIKey | XPJZFUMXHDIYCY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |