C17H25N3OS — CID 42597776
N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(dimethylamino)acetamide (PubChem CID 42597776) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(dimethylamino)acetamide.
| Compound Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 42597776 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C17H25N3OS/c1-20(2)9-15(21)19-16-18-14(10-22-16)17-6-11-3-12(7-17)5-13(4-11)8-17/h10-13H,3-9H2,1-2H3,(H,18,19,21) |
| InChIKey | BIJKXAOYEVFKIQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |