C33H35N3OPS+ — CID 4205633
[[4-(1-adamantyl)-1,3-thiazol-2-yl]carbamoylamino]methyl-triphenylphosphanium (PubChem CID 4205633) has the molecular formula C33H35N3OPS+ and a molecular weight of 552.70 g/mol. Its IUPAC name is [[4-(1-adamantyl)-1,3-thiazol-2-yl]carbamoylamino]methyl-triphenylphosphanium.
| Compound Name | [[4-(1-adamantyl)-1,3-thiazol-2-yl]carbamoylamino]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 4205633 |
| Molecular Formula | C33H35N3OPS+ |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | [[4-(1-adamantyl)-1,3-thiazol-2-yl]carbamoylamino]methyl-triphenylphosphanium |
| SMILES | O=C(NC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C33H34N3OPS/c37-31(36-32-35-30(22-39-32)33-19-24-16-25(20-33)18-26(17-24)21-33)34-23-38(27-10-4-1-5-11-27,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-15,22,24-26H,16-21,23H2,(H-,34,35,36,37)/p+1 |
| InChIKey | GSTMJCDWMBVTSU-UHFFFAOYSA-O |
| XLogP | 6.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|