C22H33N3O2S — CID 3607909
N'-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-hexylpropanediamide (PubChem CID 3607909) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is N'-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-hexylpropanediamide.
| Compound Name | N'-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-hexylpropanediamide |
|---|---|
| PubChem CID | 3607909 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N'-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-hexylpropanediamide |
| SMILES | CCCCCCNC(=O)CC(=O)Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C22H33N3O2S/c1-2-3-4-5-6-23-19(26)10-20(27)25-21-24-18(14-28-21)22-11-15-7-16(12-22)9-17(8-15)13-22/h14-17H,2-13H2,1H3,(H,23,26)(H,24,25,27) |
| InChIKey | WBFFJICOYBCUMR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|