C22H24N4O4S — CID 24575875
N-[2-[[4-(1-adamantyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 24575875) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[2-[[4-(1-adamantyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[[4-(1-adamantyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24575875 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[2-[[4-(1-adamantyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | O=C(CNC(=O)c1cccc([N+](=O)[O-])c1)Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C22H24N4O4S/c27-19(11-23-20(28)16-2-1-3-17(7-16)26(29)30)25-21-24-18(12-31-21)22-8-13-4-14(9-22)6-15(5-13)10-22/h1-3,7,12-15H,4-6,8-11H2,(H,23,28)(H,24,25,27) |
| InChIKey | RAUZCMQGLWLXFG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|