C20H15N5O8S — CID 2123578
[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 2123578) has the molecular formula C20H15N5O8S and a molecular weight of 485.43 g/mol. Its IUPAC name is [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2123578 |
| Molecular Formula | C20H15N5O8S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C20H15N5O8S/c26-17(23-20-22-16(11-34-20)12-3-1-5-14(7-12)24(29)30)10-33-18(27)9-21-19(28)13-4-2-6-15(8-13)25(31)32/h1-8,11H,9-10H2,(H,21,28)(H,22,23,26) |
| InChIKey | TWSYETPJYWAOBD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 183.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|