C19H18N4O7 — CID 34394010
[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 34394010) has the molecular formula C19H18N4O7 and a molecular weight of 414.37 g/mol. Its IUPAC name is [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 34394010 |
| Molecular Formula | C19H18N4O7 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | CNC(=O)c1cccc(NC(=O)COC(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H18N4O7/c1-20-18(26)12-4-2-6-14(8-12)22-16(24)11-30-17(25)10-21-19(27)13-5-3-7-15(9-13)23(28)29/h2-9H,10-11H2,1H3,(H,20,26)(H,21,27)(H,22,24) |
| InChIKey | NDHPMTYASHMKML-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|