C21H22ClN3O6 — CID 41219983
[2-(3-chloro-2,6-diethylanilino)-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 41219983) has the molecular formula C21H22ClN3O6 and a molecular weight of 447.88 g/mol. Its IUPAC name is [2-(3-chloro-2,6-diethylanilino)-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-(3-chloro-2,6-diethylanilino)-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 41219983 |
| Molecular Formula | C21H22ClN3O6 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | [2-(3-chloro-2,6-diethylanilino)-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)COC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22ClN3O6/c1-3-13-8-9-17(22)16(4-2)20(13)24-18(26)12-31-19(27)11-23-21(28)14-6-5-7-15(10-14)25(29)30/h5-10H,3-4,11-12H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | FJXHWNZNKXEZBA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|